ChemNet > CAS > 227958-47-6 methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate
227958-47-6 methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate
| Ονομασία του προϊόντος |
methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate |
| Συνώνυμα |
methyl 3-[(bromoacetyl)amino]thiophene-2-carboxylate |
| MF |
C8H8BrNO3S |
| Μοριακό βάρος |
278.123 |
| InChI |
InChI=1/C8H8BrNO3S/c1-13-8(12)7-5(2-3-14-7)10-6(11)4-9/h2-3H,4H2,1H3,(H,10,11) |
| CAS ΟΧΙ |
227958-47-6 |
| Μοριακή δομή |
![227958-47-6 methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate](https://images-a.chemnet.com/suppliers/chembase/297/29743.gif)
|
| Πυκνότητα |
1.705g/cm3 |
| Σημείο τήξης |
89℃ |
| Σημείο βρασμού |
442.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.635 |
| Σημείο ανάφλεξης |
221.1°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
